C20H26O3 — CID 155569037
(5S,8S,11S)-4,8,11-trimethyl-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-diene-7,12-dione (PubChem CID 155569037) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (5S,8S,11S)-4,8,11-trimethyl-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-diene-7,12-dione.
| Compound Name | (5S,8S,11S)-4,8,11-trimethyl-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-diene-7,12-dione |
|---|---|
| PubChem CID | 155569037 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (5S,8S,11S)-4,8,11-trimethyl-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-diene-7,12-dione |
| SMILES | CC1=CCC23OC4(C[C@]2(C)C(=O)C=C3C(C)C)[C@H](C)C(=O)C[C@@H]14 |
| InChI | InChI=1S/C20H26O3/c1-11(2)14-9-17(22)18(5)10-19-13(4)16(21)8-15(19)12(3)6-7-20(14,18)23-19/h6,9,11,13,15H,7-8,10H2,1-5H3/t13-,15+,18-,19?,20?/m1/s1 |
| InChIKey | XZAMUHQMNDNZKR-UCQUGRJRSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|