C22H12Br2N4 — CID 155602097
4,7-dibromo-2,9-dipyridin-2-yl-1,10-phenanthroline (PubChem CID 155602097) has the molecular formula C22H12Br2N4 and a molecular weight of 492.17 g/mol. Its IUPAC name is 4,7-dibromo-2,9-dipyridin-2-yl-1,10-phenanthroline.
| Compound Name | 4,7-dibromo-2,9-dipyridin-2-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 155602097 |
| Molecular Formula | C22H12Br2N4 |
| Molecular Weight | 492.17 g/mol |
| Exact Mass | 489.94 |
| IUPAC Name | 4,7-dibromo-2,9-dipyridin-2-yl-1,10-phenanthroline |
| SMILES | Brc1cc(-c2ccccn2)nc2c1ccc1c(Br)cc(-c3ccccn3)nc12 |
| InChI | InChI=1S/C22H12Br2N4/c23-15-11-19(17-5-1-3-9-25-17)27-21-13(15)7-8-14-16(24)12-20(28-22(14)21)18-6-2-4-10-26-18/h1-12H |
| InChIKey | DOKOCYUQAYPQBY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.17 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|