C35H42F2O8S2 — CID 155623585
2-[2-[4-[(4-tert-butylphenyl)-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate (PubChem CID 155623585) has the molecular formula C35H42F2O8S2 and a molecular weight of 692.84 g/mol. Its IUPAC name is 2-[2-[4-[(4-tert-butylphenyl)-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2-[4-[(4-tert-butylphenyl)-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 155623585 |
| Molecular Formula | C35H42F2O8S2 |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | 2-[2-[4-[(4-tert-butylphenyl)-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfonio]-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate |
| SMILES | Cc1cc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C3(C)OCC(C)(C)CO3)cc2)cc(C)c1OC(=O)COCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C35H42F2O8S2/c1-23-17-29(18-24(2)31(23)45-30(38)19-42-22-35(36,37)47(39,40)41)46(27-13-9-25(10-14-27)32(3,4)5)28-15-11-26(12-16-28)34(8)43-20-33(6,7)21-44-34/h9-18H,19-22H2,1-8H3 |
| InChIKey | BSIUEIHVMVZRAQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|