C18H14ClNO2 — CID 155625915
2-(2-chloro-4,6-dimethylanilino)naphthalene-1,4-dione (PubChem CID 155625915) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylanilino)naphthalene-1,4-dione.
| Compound Name | 2-(2-chloro-4,6-dimethylanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 155625915 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylanilino)naphthalene-1,4-dione |
| SMILES | Cc1cc(C)c(NC2=CC(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClNO2/c1-10-7-11(2)17(14(19)8-10)20-15-9-16(21)12-5-3-4-6-13(12)18(15)22/h3-9,20H,1-2H3 |
| InChIKey | XGXMVMMDDQDSJP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|