About 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate
2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate (PubChem CID 155635336) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate |
| PubChem CID | 155635336 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate |
| SMILES | C=C(C(=C)C(=O)OCCO)C(=O)NCCO |
| InChI | InChI=1S/C10H15NO5/c1-7(9(14)11-3-4-12)8(2)10(15)16-6-5-13/h12-13H,1-6H2,(H,11,14) |
| InChIKey | UFNVQXDYAAPDBF-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate?
The IUPAC name of 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate (CID 155635336) is 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate.
What is the SMILES notation for 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate?
The canonical SMILES for 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate is C=C(C(=C)C(=O)OCCO)C(=O)NCCO.
What is the InChIKey of 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate?
The InChIKey is UFNVQXDYAAPDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c1-7(9(14)11-3-4-12)8(2)10(15)16-6-5-13/h12-13H,1-6H2,(H,11,14).
What are the key properties of 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate?
2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate has a molecular weight of 229.23 g/mol, XLogP of -1.26, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 3-(2-hydroxyethylcarbamoyl)-2-methylidenebut-3-enoate is sourced from PubChem (CID 155635336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).