C20H23N11O6 — CID 155664411
(2S)-2-[amino-[4-[amino-[[2-(diaminoamino)-4-oxo-3H-pteridin-6-yl]methyl]amino]benzoyl]amino]-4-methylidenepentanedioic acid (PubChem CID 155664411) has the molecular formula C20H23N11O6 and a molecular weight of 513.48 g/mol. Its IUPAC name is (2S)-2-[amino-[4-[amino-[[2-(diaminoamino)-4-oxo-3H-pteridin-6-yl]methyl]amino]benzoyl]amino]-4-methylidenepentanedioic acid.
| Compound Name | (2S)-2-[amino-[4-[amino-[[2-(diaminoamino)-4-oxo-3H-pteridin-6-yl]methyl]amino]benzoyl]amino]-4-methylidenepentanedioic acid |
|---|---|
| PubChem CID | 155664411 |
| Molecular Formula | C20H23N11O6 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (2S)-2-[amino-[4-[amino-[[2-(diaminoamino)-4-oxo-3H-pteridin-6-yl]methyl]amino]benzoyl]amino]-4-methylidenepentanedioic acid |
| SMILES | C=C(C[C@@H](C(=O)O)N(N)C(=O)c1ccc(N(N)Cc2cnc3nc(N(N)N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C20H23N11O6/c1-9(18(34)35)6-13(19(36)37)30(22)17(33)10-2-4-12(5-3-10)29(21)8-11-7-25-15-14(26-11)16(32)28-20(27-15)31(23)24/h2-5,7,13H,1,6,8,21-24H2,(H,34,35)(H,36,37)(H,25,27,28,32)/t13-/m0/s1 |
| InChIKey | DKWYJAXBSKWSLK-ZDUSSCGKSA-N |
| XLogP | -2.05 |
| TPSA | 277.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|