C20H23N7O6 — CID 174695780
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid (PubChem CID 174695780) has the molecular formula C20H23N7O6 and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid |
|---|---|
| PubChem CID | 174695780 |
| Molecular Formula | C20H23N7O6 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid |
| SMILES | C=C(CC(NC(=O)C1C=CC(NCc2cnc3nc(N)[nH]c(=O)c3n2)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H23N7O6/c1-9(18(30)31)6-13(19(32)33)25-16(28)10-2-4-11(5-3-10)22-7-12-8-23-15-14(24-12)17(29)27-20(21)26-15/h2,4,8,10-11,13,22H,1,3,5-7H2,(H,25,28)(H,30,31)(H,32,33)(H3,21,23,26,27,29) |
| InChIKey | SOCUNBZFSFGBRU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 213.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|