C14H21N3O5S2 — CID 155671019
1-[bis(ethylsulfonyl)methylideneamino]-3-(2,6-dimethylphenyl)urea (PubChem CID 155671019) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[bis(ethylsulfonyl)methylideneamino]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[bis(ethylsulfonyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 155671019 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[bis(ethylsulfonyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
| SMILES | CCS(=O)(=O)C(=NNC(=O)Nc1c(C)cccc1C)S(=O)(=O)CC |
| InChI | InChI=1S/C14H21N3O5S2/c1-5-23(19,20)14(24(21,22)6-2)17-16-13(18)15-12-10(3)8-7-9-11(12)4/h7-9H,5-6H2,1-4H3,(H2,15,16,18) |
| InChIKey | ZCSNNGQGUCSQAM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|