C12H11ClN2O2S — CID 155676643
1-(2-chloro-1,3-thiazol-5-yl)-N-(2,5-dimethoxyphenyl)methanimine (PubChem CID 155676643) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 1-(2-chloro-1,3-thiazol-5-yl)-N-(2,5-dimethoxyphenyl)methanimine.
| Compound Name | 1-(2-chloro-1,3-thiazol-5-yl)-N-(2,5-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 155676643 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-(2-chloro-1,3-thiazol-5-yl)-N-(2,5-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(OC)c(/N=C/c2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-16-8-3-4-11(17-2)10(5-8)14-6-9-7-15-12(13)18-9/h3-7H,1-2H3/b14-6+ |
| InChIKey | CKAXPOJNUFNCLD-MKMNVTDBSA-N |
| XLogP | 3.56 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|