C9H12O6 — CID 155682588
1,2,5,6,8,9-hexaoxatrispiro[2.0.24.0.27.63]pentadecane (PubChem CID 155682588) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1,2,5,6,8,9-hexaoxatrispiro[2.0.24.0.27.63]pentadecane.
| Compound Name | 1,2,5,6,8,9-hexaoxatrispiro[2.0.24.0.27.63]pentadecane |
|---|---|
| PubChem CID | 155682588 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1,2,5,6,8,9-hexaoxatrispiro[2.0.24.0.27.63]pentadecane |
| SMILES | C1CCCC2(OO2)C2(OO2)C2(CC1)OO2 |
| InChI | InChI=1S/C9H12O6/c1-2-4-6-8(12-13-8)9(14-15-9)7(5-3-1)10-11-7/h1-6H2 |
| InChIKey | AHHCNFCASJMBCJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|