C24H32FN5O5 — CID 155685248
10-[(1R)-1-[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]pent-4-ynoxy]-10-oxodecanoic acid (PubChem CID 155685248) has the molecular formula C24H32FN5O5 and a molecular weight of 489.55 g/mol. Its IUPAC name is 10-[(1R)-1-[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]pent-4-ynoxy]-10-oxodecanoic acid.
| Compound Name | 10-[(1R)-1-[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]pent-4-ynoxy]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 155685248 |
| Molecular Formula | C24H32FN5O5 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 10-[(1R)-1-[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]pent-4-ynoxy]-10-oxodecanoic acid |
| SMILES | C#CCC[C@@H](OC(=O)CCCCCCCCC(=O)O)[C@@H]1CC[C@H](n2cnc3c(N)nc(F)nc32)O1 |
| InChI | InChI=1S/C24H32FN5O5/c1-2-3-10-16(35-20(33)12-9-7-5-4-6-8-11-19(31)32)17-13-14-18(34-17)30-15-27-21-22(26)28-24(25)29-23(21)30/h1,15-18H,3-14H2,(H,31,32)(H2,26,28,29)/t16-,17+,18-/m1/s1 |
| InChIKey | GMZRKFFDHKPMTP-FGTMMUONSA-N |
| XLogP | 3.76 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|