C12H18Cl2 — CID 155706977
2,5-dichloro-1-methyl-3-propan-2-ylbenzene;ethane (PubChem CID 155706977) has the molecular formula C12H18Cl2 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2,5-dichloro-1-methyl-3-propan-2-ylbenzene;ethane.
| Compound Name | 2,5-dichloro-1-methyl-3-propan-2-ylbenzene;ethane |
|---|---|
| PubChem CID | 155706977 |
| Molecular Formula | C12H18Cl2 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2,5-dichloro-1-methyl-3-propan-2-ylbenzene;ethane |
| SMILES | CC.Cc1cc(Cl)cc(C(C)C)c1Cl |
| InChI | InChI=1S/C10H12Cl2.C2H6/c1-6(2)9-5-8(11)4-7(3)10(9)12;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | AQWAQVWGNORXAJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |