C29H31N3O3 — CID 155710776
5-[(Z)-3-amino-2-[(4-oxocyclohexyl)iminomethyl]prop-2-enyl]-8-[(4-methoxyphenyl)methylamino]naphthalene-1-carbaldehyde (PubChem CID 155710776) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 5-[(Z)-3-amino-2-[(4-oxocyclohexyl)iminomethyl]prop-2-enyl]-8-[(4-methoxyphenyl)methylamino]naphthalene-1-carbaldehyde.
| Compound Name | 5-[(Z)-3-amino-2-[(4-oxocyclohexyl)iminomethyl]prop-2-enyl]-8-[(4-methoxyphenyl)methylamino]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 155710776 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-[(Z)-3-amino-2-[(4-oxocyclohexyl)iminomethyl]prop-2-enyl]-8-[(4-methoxyphenyl)methylamino]naphthalene-1-carbaldehyde |
| SMILES | COc1ccc(CNc2ccc(CC(=C/N)/C=N/C3CCC(=O)CC3)c3cccc(C=O)c23)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-35-26-12-5-20(6-13-26)17-32-28-14-7-22(27-4-2-3-23(19-33)29(27)28)15-21(16-30)18-31-24-8-10-25(34)11-9-24/h2-7,12-14,16,18-19,24,32H,8-11,15,17,30H2,1H3/b21-16-,31-18+ |
| InChIKey | YBBATLZCAXDFRC-JDYDLEPLSA-N |
| XLogP | 5.24 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|