C31H36 — CID 155718078
(1Z,3Z,6Z)-9-methylidene-7-[(1Z,3Z)-penta-1,3-dienyl]-8,8-diphenylcyclonona-1,3,6-triene;2-methylpropane (PubChem CID 155718078) has the molecular formula C31H36 and a molecular weight of 408.63 g/mol. Its IUPAC name is (1Z,3Z,6Z)-9-methylidene-7-[(1Z,3Z)-penta-1,3-dienyl]-8,8-diphenylcyclonona-1,3,6-triene;2-methylpropane.
| Compound Name | (1Z,3Z,6Z)-9-methylidene-7-[(1Z,3Z)-penta-1,3-dienyl]-8,8-diphenylcyclonona-1,3,6-triene;2-methylpropane |
|---|---|
| PubChem CID | 155718078 |
| Molecular Formula | C31H36 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (1Z,3Z,6Z)-9-methylidene-7-[(1Z,3Z)-penta-1,3-dienyl]-8,8-diphenylcyclonona-1,3,6-triene;2-methylpropane |
| SMILES | C=C1/C=C\C=C/C/C=C(/C=C\C=C/C)C1(c1ccccc1)c1ccccc1.CC(C)C |
| InChI | InChI=1S/C27H26.C4H10/c1-3-4-9-17-24-18-11-6-5-10-16-23(2)27(24,25-19-12-7-13-20-25)26-21-14-8-15-22-26;1-4(2)3/h3-10,12-22H,2,11H2,1H3;4H,1-3H3/b4-3-,6-5-,16-10-,17-9-,24-18-; |
| InChIKey | RHYFRXKAIMRNEM-UZGXJVMTSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|