C16H28N2 — CID 155719592
(2E)-2-(2,2-dimethylpropylidene)-N-methyl-4-propan-2-ylpyridin-3-imine;ethane (PubChem CID 155719592) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethylpropylidene)-N-methyl-4-propan-2-ylpyridin-3-imine;ethane.
| Compound Name | (2E)-2-(2,2-dimethylpropylidene)-N-methyl-4-propan-2-ylpyridin-3-imine;ethane |
|---|---|
| PubChem CID | 155719592 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (2E)-2-(2,2-dimethylpropylidene)-N-methyl-4-propan-2-ylpyridin-3-imine;ethane |
| SMILES | C/N=C1\C(C(C)C)=CC=N\C1=C\C(C)(C)C.CC |
| InChI | InChI=1S/C14H22N2.C2H6/c1-10(2)11-7-8-16-12(13(11)15-6)9-14(3,4)5;1-2/h7-10H,1-6H3;1-2H3/b12-9+,15-13+; |
| InChIKey | DREQCYCXJBILIB-ZZIUBGMCSA-N |
| XLogP | 4.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|