C29H36N2O6 — CID 155721388
[3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl N-(3-oxopropyl)carbamate;4-ethyl-2-(methylamino)phenol;formic acid (PubChem CID 155721388) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl N-(3-oxopropyl)carbamate;4-ethyl-2-(methylamino)phenol;formic acid.
| Compound Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl N-(3-oxopropyl)carbamate;4-ethyl-2-(methylamino)phenol;formic acid |
|---|---|
| PubChem CID | 155721388 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl N-(3-oxopropyl)carbamate;4-ethyl-2-(methylamino)phenol;formic acid |
| SMILES | C=CC1=C(/C=C\C)C(COC(=O)NCCC=O)c2ccccc21.CCc1ccc(O)c(NC)c1.O=CO |
| InChI | InChI=1S/C19H21NO3.C9H13NO.CH2O2/c1-3-8-15-14(4-2)16-9-5-6-10-17(16)18(15)13-23-19(22)20-11-7-12-21;1-3-7-4-5-9(11)8(6-7)10-2;2-1-3/h3-6,8-10,12,18H,2,7,11,13H2,1H3,(H,20,22);4-6,10-11H,3H2,1-2H3;1H,(H,2,3)/b8-3-;; |
| InChIKey | NYPWMBLBQLPXBI-AFLHAROQSA-N |
| XLogP | 5.31 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|