C22H25NO3 — CID 145047292
[3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl 2-formylpiperidine-1-carboxylate (PubChem CID 145047292) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl 2-formylpiperidine-1-carboxylate.
| Compound Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl 2-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145047292 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methyl 2-formylpiperidine-1-carboxylate |
| SMILES | C=CC1=C(/C=C\C)C(COC(=O)N2CCCCC2C=O)c2ccccc21 |
| InChI | InChI=1S/C22H25NO3/c1-3-9-18-17(4-2)19-11-5-6-12-20(19)21(18)15-26-22(25)23-13-8-7-10-16(23)14-24/h3-6,9,11-12,14,16,21H,2,7-8,10,13,15H2,1H3/b9-3- |
| InChIKey | HRJPMRWUSCSAGK-OQFOIZHKSA-N |
| XLogP | 4.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|