C31H38Cl2N2O6 — CID 15572550
3-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]propyl 9H-xanthene-9-carboxylate;dihydrochloride (PubChem CID 15572550) has the molecular formula C31H38Cl2N2O6 and a molecular weight of 605.56 g/mol. Its IUPAC name is 3-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]propyl 9H-xanthene-9-carboxylate;dihydrochloride.
| Compound Name | 3-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]propyl 9H-xanthene-9-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 15572550 |
| Molecular Formula | C31H38Cl2N2O6 |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 3-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]propyl 9H-xanthene-9-carboxylate;dihydrochloride |
| SMILES | COc1cc(CN2CCN(CCCOC(=O)C3c4ccccc4Oc4ccccc43)CC2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C31H36N2O6.2ClH/c1-35-27-19-22(20-28(36-2)30(27)37-3)21-33-16-14-32(15-17-33)13-8-18-38-31(34)29-23-9-4-6-11-25(23)39-26-12-7-5-10-24(26)29;;/h4-7,9-12,19-20,29H,8,13-18,21H2,1-3H3;2*1H |
| InChIKey | IUUNRUQKOZOTGA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|