C23H23N3O2S — CID 155731228
2-phenylethyl 3,7-bis(methylamino)phenothiazine-10-carboxylate (PubChem CID 155731228) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-phenylethyl 3,7-bis(methylamino)phenothiazine-10-carboxylate.
| Compound Name | 2-phenylethyl 3,7-bis(methylamino)phenothiazine-10-carboxylate |
|---|---|
| PubChem CID | 155731228 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-phenylethyl 3,7-bis(methylamino)phenothiazine-10-carboxylate |
| SMILES | CNc1ccc2c(c1)Sc1cc(NC)ccc1N2C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-24-17-8-10-19-21(14-17)29-22-15-18(25-2)9-11-20(22)26(19)23(27)28-13-12-16-6-4-3-5-7-16/h3-11,14-15,24-25H,12-13H2,1-2H3 |
| InChIKey | DRBWWQDVPUXJCX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |