C21H20ClIN5O6P — CID 155736623
[7-amino-6-[3-[[6-[(2-chloro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]-1λ3-ioda-2-azacyclohepta-3,5,7-trien-2-yl]methyl dihydrogen phosphate (PubChem CID 155736623) has the molecular formula C21H20ClIN5O6P and a molecular weight of 631.75 g/mol. Its IUPAC name is [7-amino-6-[3-[[6-[(2-chloro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]-1λ3-ioda-2-azacyclohepta-3,5,7-trien-2-yl]methyl dihydrogen phosphate.
| Compound Name | [7-amino-6-[3-[[6-[(2-chloro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]-1λ3-ioda-2-azacyclohepta-3,5,7-trien-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736623 |
| Molecular Formula | C21H20ClIN5O6P |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 630.99 |
| IUPAC Name | [7-amino-6-[3-[[6-[(2-chloro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]-1λ3-ioda-2-azacyclohepta-3,5,7-trien-2-yl]methyl dihydrogen phosphate |
| SMILES | NC1=IN(COP(=O)(O)O)C=CC=C1c1cc(Cc2ccc(OCc3ccnc(Cl)c3)nc2)no1 |
| InChI | InChI=1S/C21H20ClIN5O6P/c22-19-9-15(5-6-25-19)12-32-20-4-3-14(11-26-20)8-16-10-18(34-27-16)17-2-1-7-28(23-21(17)24)13-33-35(29,30)31/h1-7,9-11H,8,12-13,24H2,(H2,29,30,31) |
| InChIKey | BQSCDYJVWDIPBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|