C20H31BN4O4 — CID 155737360
[(1R)-1-[2-(2,3-dihydropyrazine-5-carbonylamino)propanoylamino]-3-methylbutyl]boronic acid;toluene (PubChem CID 155737360) has the molecular formula C20H31BN4O4 and a molecular weight of 402.30 g/mol. Its IUPAC name is [(1R)-1-[2-(2,3-dihydropyrazine-5-carbonylamino)propanoylamino]-3-methylbutyl]boronic acid;toluene.
| Compound Name | [(1R)-1-[2-(2,3-dihydropyrazine-5-carbonylamino)propanoylamino]-3-methylbutyl]boronic acid;toluene |
|---|---|
| PubChem CID | 155737360 |
| Molecular Formula | C20H31BN4O4 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1R)-1-[2-(2,3-dihydropyrazine-5-carbonylamino)propanoylamino]-3-methylbutyl]boronic acid;toluene |
| SMILES | CC(C)C[C@H](NC(=O)C(C)NC(=O)C1=NCCN=C1)B(O)O.Cc1ccccc1 |
| InChI | InChI=1S/C13H23BN4O4.C7H8/c1-8(2)6-11(14(21)22)18-12(19)9(3)17-13(20)10-7-15-4-5-16-10;1-7-5-3-2-4-6-7/h7-9,11,21-22H,4-6H2,1-3H3,(H,17,20)(H,18,19);2-6H,1H3/t9?,11-;/m0./s1 |
| InChIKey | DBWSQRMKIZWGFB-VLTGDTDDSA-N |
| XLogP | 0.55 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|