C17H22N2 — CID 155743377
2-ethyl-5,6-dihydro-1,10-phenanthroline;propane (PubChem CID 155743377) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-ethyl-5,6-dihydro-1,10-phenanthroline;propane.
| Compound Name | 2-ethyl-5,6-dihydro-1,10-phenanthroline;propane |
|---|---|
| PubChem CID | 155743377 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-ethyl-5,6-dihydro-1,10-phenanthroline;propane |
| SMILES | CCC.CCc1ccc2c(n1)-c1ncccc1CC2 |
| InChI | InChI=1S/C14H14N2.C3H8/c1-2-12-8-7-11-6-5-10-4-3-9-15-13(10)14(11)16-12;1-3-2/h3-4,7-9H,2,5-6H2,1H3;3H2,1-2H3 |
| InChIKey | NXBNGDXOLUJTND-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |