C16H14N2 — CID 175804629
5,6,9,10-tetrahydrobenzo[b][1,10]phenanthroline (PubChem CID 175804629) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5,6,9,10-tetrahydrobenzo[b][1,10]phenanthroline.
| Compound Name | 5,6,9,10-tetrahydrobenzo[b][1,10]phenanthroline |
|---|---|
| PubChem CID | 175804629 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5,6,9,10-tetrahydrobenzo[b][1,10]phenanthroline |
| SMILES | C1=c2cc3c(nc2=CCC1)-c1ncccc1CC3 |
| InChI | InChI=1S/C16H14N2/c1-2-6-14-12(4-1)10-13-8-7-11-5-3-9-17-15(11)16(13)18-14/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | MLLPHAJFNXMVGF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |