C17H18N2 — CID 91247823
N-[(1R)-1-phenylethyl]-5,6-dihydroquinolin-8-amine (PubChem CID 91247823) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-5,6-dihydroquinolin-8-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-5,6-dihydroquinolin-8-amine |
|---|---|
| PubChem CID | 91247823 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-5,6-dihydroquinolin-8-amine |
| SMILES | C[C@@H](NC1=CCCc2cccnc21)c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-13(14-7-3-2-4-8-14)19-16-11-5-9-15-10-6-12-18-17(15)16/h2-4,6-8,10-13,19H,5,9H2,1H3/t13-/m1/s1 |
| InChIKey | GWDMWNYFFKIISA-CYBMUJFWSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |