C27H28FN5O5 — CID 155746486
7-(dimethoxymethyl)-N-[5-[2-(2-fluoro-3,5-dimethoxy-6-methylphenyl)ethynyl]pyrimidin-2-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 155746486) has the molecular formula C27H28FN5O5 and a molecular weight of 521.55 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-N-[5-[2-(2-fluoro-3,5-dimethoxy-6-methylphenyl)ethynyl]pyrimidin-2-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 7-(dimethoxymethyl)-N-[5-[2-(2-fluoro-3,5-dimethoxy-6-methylphenyl)ethynyl]pyrimidin-2-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 155746486 |
| Molecular Formula | C27H28FN5O5 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 7-(dimethoxymethyl)-N-[5-[2-(2-fluoro-3,5-dimethoxy-6-methylphenyl)ethynyl]pyrimidin-2-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COc1cc(OC)c(F)c(C#Cc2cnc(NC(=O)N3CCCc4ccc(C(OC)OC)nc43)nc2)c1C |
| InChI | InChI=1S/C27H28FN5O5/c1-16-19(23(28)22(36-3)13-21(16)35-2)10-8-17-14-29-26(30-15-17)32-27(34)33-12-6-7-18-9-11-20(31-24(18)33)25(37-4)38-5/h9,11,13-15,25H,6-7,12H2,1-5H3,(H,29,30,32,34) |
| InChIKey | XBKSDCQKQNBDGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|