C11H12ClN4O3S+ — CID 155762380
3-[4-(2-chloropyrimidin-4-yl)pyridazin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 155762380) has the molecular formula C11H12ClN4O3S+ and a molecular weight of 315.76 g/mol. Its IUPAC name is 3-[4-(2-chloropyrimidin-4-yl)pyridazin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-(2-chloropyrimidin-4-yl)pyridazin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 155762380 |
| Molecular Formula | C11H12ClN4O3S+ |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-[4-(2-chloropyrimidin-4-yl)pyridazin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCC[n+]1ccc(-c2ccnc(Cl)n2)cn1 |
| InChI | InChI=1S/C11H11ClN4O3S/c12-11-13-4-2-10(15-11)9-3-6-16(14-8-9)5-1-7-20(17,18)19/h2-4,6,8H,1,5,7H2/p+1 |
| InChIKey | SVYGXRVGKURULA-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|