C14H28O3SSi — CID 155764669
(4aR,7R,7aS)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline (PubChem CID 155764669) has the molecular formula C14H28O3SSi and a molecular weight of 304.53 g/mol. Its IUPAC name is (4aR,7R,7aS)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,7R,7aS)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 155764669 |
| Molecular Formula | C14H28O3SSi |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (4aR,7R,7aS)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline |
| SMILES | CO[C@H]1CS[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C14H28O3SSi/c1-13(2,3)19(14(4,5)6)16-8-11-12(17-19)10(15-7)9-18-11/h10-12H,8-9H2,1-7H3/t10-,11+,12-/m0/s1 |
| InChIKey | ZYLVYHLJHHSPJR-TUAOUCFPSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|