About hydroxymethanone;phenylboronic acid;tungsten(2+)
hydroxymethanone;phenylboronic acid;tungsten(2+) (PubChem CID 155769533) has the molecular formula C7H7BO4W
and a molecular weight of 349.78 g/mol. Its IUPAC name is hydroxymethanone;phenylboronic acid;tungsten(2+).
Molecular Properties
| Compound Name | hydroxymethanone;phenylboronic acid;tungsten(2+) |
| PubChem CID | 155769533 |
| Molecular Formula | C7H7BO4W |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | hydroxymethanone;phenylboronic acid;tungsten(2+) |
| SMILES | O=[C-]O.OB(O)c1[c-]cccc1.[W+2] |
| InChI | InChI=1S/C6H6BO2.CHO2.W/c8-7(9)6-4-2-1-3-5-6;2-1-3;/h1-4,8-9H;(H,2,3);/q2*-1;+2 |
| InChIKey | UIJSJIFQTXJRNV-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethanone;phenylboronic acid;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethanone;phenylboronic acid;tungsten(2+)?
The IUPAC name of hydroxymethanone;phenylboronic acid;tungsten(2+) (CID 155769533) is hydroxymethanone;phenylboronic acid;tungsten(2+).
What is the SMILES notation for hydroxymethanone;phenylboronic acid;tungsten(2+)?
The canonical SMILES for hydroxymethanone;phenylboronic acid;tungsten(2+) is O=[C-]O.OB(O)c1[c-]cccc1.[W+2].
What is the InChIKey of hydroxymethanone;phenylboronic acid;tungsten(2+)?
The InChIKey is UIJSJIFQTXJRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BO2.CHO2.W/c8-7(9)6-4-2-1-3-5-6;2-1-3;/h1-4,8-9H;(H,2,3);/q2*-1;+2.
What are the key properties of hydroxymethanone;phenylboronic acid;tungsten(2+)?
hydroxymethanone;phenylboronic acid;tungsten(2+) has a molecular weight of 349.78 g/mol, XLogP of -1.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethanone;phenylboronic acid;tungsten(2+) is sourced from PubChem (CID 155769533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).