C27H15NO6 — CID 155803578
11-hydroxy-2-(3-nitrophenyl)-13-oxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,16,18,20-nonaene-15,22-dione (PubChem CID 155803578) has the molecular formula C27H15NO6 and a molecular weight of 449.42 g/mol. Its IUPAC name is 11-hydroxy-2-(3-nitrophenyl)-13-oxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,16,18,20-nonaene-15,22-dione.
| Compound Name | 11-hydroxy-2-(3-nitrophenyl)-13-oxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,16,18,20-nonaene-15,22-dione |
|---|---|
| PubChem CID | 155803578 |
| Molecular Formula | C27H15NO6 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 11-hydroxy-2-(3-nitrophenyl)-13-oxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,16,18,20-nonaene-15,22-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C(c1cccc([N+](=O)[O-])c1)c1c(c(O)cc3ccccc13)O2 |
| InChI | InChI=1S/C27H15NO6/c29-20-13-14-6-1-2-9-17(14)22-21(15-7-5-8-16(12-15)28(32)33)23-24(30)18-10-3-4-11-19(18)25(31)27(23)34-26(20)22/h1-13,21,29H |
| InChIKey | SKTVIGCIGNFZOO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|