C33H17N3O5 — CID 132820070
30-(4-nitrophenyl)-19-oxa-3,10-diazaheptacyclo[16.12.0.02,11.04,9.012,17.020,29.022,27]triaconta-1(18),2,4,6,8,10,12,14,16,20(29),22,24,26-tridecaene-21,28-dione (PubChem CID 132820070) has the molecular formula C33H17N3O5 and a molecular weight of 535.52 g/mol. Its IUPAC name is 30-(4-nitrophenyl)-19-oxa-3,10-diazaheptacyclo[16.12.0.02,11.04,9.012,17.020,29.022,27]triaconta-1(18),2,4,6,8,10,12,14,16,20(29),22,24,26-tridecaene-21,28-dione.
| Compound Name | 30-(4-nitrophenyl)-19-oxa-3,10-diazaheptacyclo[16.12.0.02,11.04,9.012,17.020,29.022,27]triaconta-1(18),2,4,6,8,10,12,14,16,20(29),22,24,26-tridecaene-21,28-dione |
|---|---|
| PubChem CID | 132820070 |
| Molecular Formula | C33H17N3O5 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 30-(4-nitrophenyl)-19-oxa-3,10-diazaheptacyclo[16.12.0.02,11.04,9.012,17.020,29.022,27]triaconta-1(18),2,4,6,8,10,12,14,16,20(29),22,24,26-tridecaene-21,28-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C(c1ccc([N+](=O)[O-])cc1)c1c(c3ccccc3c3nc4ccccc4nc13)O2 |
| InChI | InChI=1S/C33H17N3O5/c37-30-20-8-2-3-9-21(20)31(38)33-27(30)25(17-13-15-18(16-14-17)36(39)40)26-29-28(34-23-11-5-6-12-24(23)35-29)19-7-1-4-10-22(19)32(26)41-33/h1-16,25H |
| InChIKey | YHJFPVJHDDYUSU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|