C18H20F4N4O3S — CID 155839514
(1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155839514) has the molecular formula C18H20F4N4O3S and a molecular weight of 448.44 g/mol. Its IUPAC name is (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839514 |
| Molecular Formula | C18H20F4N4O3S |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1csc(C[C@@H]2OC[C@H]3CN(c4ncc(F)cn4)CC[C@H]32)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H19FN4OS.C2HF3O2/c1-10-9-23-15(20-10)4-14-13-2-3-21(7-11(13)8-22-14)16-18-5-12(17)6-19-16;3-2(4,5)1(6)7/h5-6,9,11,13-14H,2-4,7-8H2,1H3;(H,6,7)/t11-,13-,14+;/m1./s1 |
| InChIKey | GSIVNPIIPSUGCI-DSNOOMGLSA-N |
| XLogP | 3.10 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |