C21H29F6N5O4S — CID 155863693
N,N-diethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863693) has the molecular formula C21H29F6N5O4S and a molecular weight of 561.55 g/mol. Its IUPAC name is N,N-diethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-diethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863693 |
| Molecular Formula | C21H29F6N5O4S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | N,N-diethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)CCC1CN(Cc2scnc2C)Cc2cncn21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5S.2C2HF3O2/c1-4-20(5-2)7-6-15-9-21(10-16-8-18-12-22(15)16)11-17-14(3)19-13-23-17;2*3-2(4,5)1(6)7/h8,12-13,15H,4-7,9-11H2,1-3H3;2*(H,6,7) |
| InChIKey | VGFZHXAVCCQVGD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |