C16H24N2O2 — CID 155912794
2-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]acetamide (PubChem CID 155912794) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]acetamide.
| Compound Name | 2-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 155912794 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]acetamide |
| SMILES | CC(C)(C)[C@H]1CN(CC(N)=O)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,3)14-10-18(11-15(17)19)9-13(20-14)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3,(H2,17,19)/t13-,14+/m0/s1 |
| InChIKey | VTIPYLZHDWXAHE-UONOGXRCSA-N |
| XLogP | 1.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |