C15H9N5O7S — CID 155925583
5-[(3,5-dinitrophenyl)methylsulfanyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 155925583) has the molecular formula C15H9N5O7S and a molecular weight of 403.33 g/mol. Its IUPAC name is 5-[(3,5-dinitrophenyl)methylsulfanyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155925583 |
| Molecular Formula | C15H9N5O7S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(SCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C15H9N5O7S/c21-18(22)11-3-1-10(2-4-11)14-16-15(27-17-14)28-8-9-5-12(19(23)24)7-13(6-9)20(25)26/h1-7H,8H2 |
| InChIKey | NPGQQLZCRKXWBM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 168.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|