C27H19Cl2N3O2 — CID 155936671
[(7S,8R)-12,13-dichloro-8-(4-methoxyphenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone (PubChem CID 155936671) has the molecular formula C27H19Cl2N3O2 and a molecular weight of 488.37 g/mol. Its IUPAC name is [(7S,8R)-12,13-dichloro-8-(4-methoxyphenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone.
| Compound Name | [(7S,8R)-12,13-dichloro-8-(4-methoxyphenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone |
|---|---|
| PubChem CID | 155936671 |
| Molecular Formula | C27H19Cl2N3O2 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [(7S,8R)-12,13-dichloro-8-(4-methoxyphenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)c3ccccc3)n3cccc3-c3nc4cc(Cl)c(Cl)cc4n32)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O2/c1-34-18-11-9-16(10-12-18)24-25(26(33)17-6-3-2-4-7-17)31-13-5-8-22(31)27-30-21-14-19(28)20(29)15-23(21)32(24)27/h2-15,24-25H,1H3/t24-,25+/m1/s1 |
| InChIKey | YMUSWPCSCVZCGE-RPBOFIJWSA-N |
| XLogP | 6.85 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |