C15H16F3N3O3S — CID 155948503
N-[(1-cyanocyclohexyl)methylsulfonyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 155948503) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[(1-cyanocyclohexyl)methylsulfonyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[(1-cyanocyclohexyl)methylsulfonyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155948503 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[(1-cyanocyclohexyl)methylsulfonyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | N#CC1(CS(=O)(=O)NC(=O)c2ccc(C(F)(F)F)cn2)CCCCC1 |
| InChI | InChI=1S/C15H16F3N3O3S/c16-15(17,18)11-4-5-12(20-8-11)13(22)21-25(23,24)10-14(9-19)6-2-1-3-7-14/h4-5,8H,1-3,6-7,10H2,(H,21,22) |
| InChIKey | LXRGVXPMRLMIIJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |