C20H20N4O2S — CID 15628886
1-[[3-(1,3-dioxolan-2-yl)quinolin-2-yl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 15628886) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[[3-(1,3-dioxolan-2-yl)quinolin-2-yl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[3-(1,3-dioxolan-2-yl)quinolin-2-yl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 15628886 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[[3-(1,3-dioxolan-2-yl)quinolin-2-yl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNc2nc3ccccc3cc2C2OCCO2)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c1-13-6-8-15(9-7-13)21-20(27)24-23-18-16(19-25-10-11-26-19)12-14-4-2-3-5-17(14)22-18/h2-9,12,19H,10-11H2,1H3,(H,22,23)(H2,21,24,27) |
| InChIKey | SMZXOQIIJVWNGO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|