C22H22N2O2 — CID 15632148
4-anilino-3-(piperidin-1-ylmethyl)naphthalene-1,2-dione (PubChem CID 15632148) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-anilino-3-(piperidin-1-ylmethyl)naphthalene-1,2-dione.
| Compound Name | 4-anilino-3-(piperidin-1-ylmethyl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 15632148 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-anilino-3-(piperidin-1-ylmethyl)naphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C(Nc2ccccc2)=C1CN1CCCCC1 |
| InChI | InChI=1S/C22H22N2O2/c25-21-18-12-6-5-11-17(18)20(23-16-9-3-1-4-10-16)19(22(21)26)15-24-13-7-2-8-14-24/h1,3-6,9-12,23H,2,7-8,13-15H2 |
| InChIKey | LWBRSUTWMLYDGH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|