C18H21ClN4O5 — CID 156505869
2-[1-[2-cyano-4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]-4-hydroxypiperidin-4-yl]acetic acid;hydrochloride (PubChem CID 156505869) has the molecular formula C18H21ClN4O5 and a molecular weight of 408.84 g/mol. Its IUPAC name is 2-[1-[2-cyano-4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]-4-hydroxypiperidin-4-yl]acetic acid;hydrochloride.
| Compound Name | 2-[1-[2-cyano-4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]-4-hydroxypiperidin-4-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 156505869 |
| Molecular Formula | C18H21ClN4O5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[1-[2-cyano-4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]-4-hydroxypiperidin-4-yl]acetic acid;hydrochloride |
| SMILES | Cl.N#Cc1cc(N2CCC(=O)NC2=O)ccc1N1CCC(O)(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H20N4O5.ClH/c19-11-12-9-13(22-6-3-15(23)20-17(22)26)1-2-14(12)21-7-4-18(27,5-8-21)10-16(24)25;/h1-2,9,27H,3-8,10H2,(H,24,25)(H,20,23,26);1H |
| InChIKey | XBGPFFLYIVFVNZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|