C16H28N2 — CID 156509234
(1E,5E)-2,5-diethyl-7-imino-3,3-dimethyl-4-propan-2-ylidenehepta-1,5-dien-1-amine (PubChem CID 156509234) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (1E,5E)-2,5-diethyl-7-imino-3,3-dimethyl-4-propan-2-ylidenehepta-1,5-dien-1-amine.
| Compound Name | (1E,5E)-2,5-diethyl-7-imino-3,3-dimethyl-4-propan-2-ylidenehepta-1,5-dien-1-amine |
|---|---|
| PubChem CID | 156509234 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (1E,5E)-2,5-diethyl-7-imino-3,3-dimethyl-4-propan-2-ylidenehepta-1,5-dien-1-amine |
| SMILES | [H]/N=C/C=C(\CC)C(=C(C)C)C(C)(C)/C(=C/N)CC |
| InChI | InChI=1S/C16H28N2/c1-7-13(9-10-17)15(12(3)4)16(5,6)14(8-2)11-18/h9-11,17H,7-8,18H2,1-6H3/b13-9+,14-11+,17-10+ |
| InChIKey | BXVCGXZBOOLTMF-QCOWLJFNSA-N |
| XLogP | 4.59 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|