C17H25NO — CID 156519396
N-[(1Z)-1-(4-methoxy-6-methylidene-3-pentylcyclohexa-2,4-dien-1-ylidene)ethyl]ethanimine (PubChem CID 156519396) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N-[(1Z)-1-(4-methoxy-6-methylidene-3-pentylcyclohexa-2,4-dien-1-ylidene)ethyl]ethanimine.
| Compound Name | N-[(1Z)-1-(4-methoxy-6-methylidene-3-pentylcyclohexa-2,4-dien-1-ylidene)ethyl]ethanimine |
|---|---|
| PubChem CID | 156519396 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-[(1Z)-1-(4-methoxy-6-methylidene-3-pentylcyclohexa-2,4-dien-1-ylidene)ethyl]ethanimine |
| SMILES | C=c1cc(OC)c(CCCCC)c/c1=C(C)/N=C/C |
| InChI | InChI=1S/C17H25NO/c1-6-8-9-10-15-12-16(14(4)18-7-2)13(3)11-17(15)19-5/h7,11-12H,3,6,8-10H2,1-2,4-5H3/b16-14-,18-7+ |
| InChIKey | PSUJQJLVKDVTIG-HZWJUJSNSA-N |
| XLogP | 3.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|