C21H29F2IO4 — CID 156523008
2,2-difluoro-3-(2-heptyl-5-iodobenzoyl)oxyheptanoic acid (PubChem CID 156523008) has the molecular formula C21H29F2IO4 and a molecular weight of 510.36 g/mol. Its IUPAC name is 2,2-difluoro-3-(2-heptyl-5-iodobenzoyl)oxyheptanoic acid.
| Compound Name | 2,2-difluoro-3-(2-heptyl-5-iodobenzoyl)oxyheptanoic acid |
|---|---|
| PubChem CID | 156523008 |
| Molecular Formula | C21H29F2IO4 |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2,2-difluoro-3-(2-heptyl-5-iodobenzoyl)oxyheptanoic acid |
| SMILES | CCCCCCCc1ccc(I)cc1C(=O)OC(CCCC)C(F)(F)C(=O)O |
| InChI | InChI=1S/C21H29F2IO4/c1-3-5-7-8-9-10-15-12-13-16(24)14-17(15)19(25)28-18(11-6-4-2)21(22,23)20(26)27/h12-14,18H,3-11H2,1-2H3,(H,26,27) |
| InChIKey | VZOPFAOIPCXUKA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|