C14H22N2O3 — CID 156537841
2-[[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 156537841) has the molecular formula C14H22N2O3 and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-[[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156537841 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 2-[[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])c1noc(CC(=C)C(=O)O)n1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-4-5-6-7-8-9-12-15-13(19-16-12)10-11(2)14(17)18/h2-10H2,1H3,(H,17,18)/i1D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2 |
| InChIKey | ZUKFBHPVYIOEEG-RORPREDISA-N |
| XLogP | 3.16 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|