C25H28N4O7 — CID 156542321
N-(2,6-dioxopiperidin-3-yl)-3-[2-[3-[[(2-methoxyacetyl)amino]methyl]anilino]-2-oxoethoxy]-2-methylbenzamide (PubChem CID 156542321) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-[2-[3-[[(2-methoxyacetyl)amino]methyl]anilino]-2-oxoethoxy]-2-methylbenzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-[2-[3-[[(2-methoxyacetyl)amino]methyl]anilino]-2-oxoethoxy]-2-methylbenzamide |
|---|---|
| PubChem CID | 156542321 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-[2-[3-[[(2-methoxyacetyl)amino]methyl]anilino]-2-oxoethoxy]-2-methylbenzamide |
| SMILES | COCC(=O)NCc1cccc(NC(=O)COc2cccc(C(=O)NC3CCC(=O)NC3=O)c2C)c1 |
| InChI | InChI=1S/C25H28N4O7/c1-15-18(24(33)28-19-9-10-21(30)29-25(19)34)7-4-8-20(15)36-14-23(32)27-17-6-3-5-16(11-17)12-26-22(31)13-35-2/h3-8,11,19H,9-10,12-14H2,1-2H3,(H,26,31)(H,27,32)(H,28,33)(H,29,30,34) |
| InChIKey | UCKNGSAELFNLRK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|