C19H19F3N2O4S — CID 156548919
3-(2-formylprop-2-enylamino)-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide (PubChem CID 156548919) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-(2-formylprop-2-enylamino)-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide.
| Compound Name | 3-(2-formylprop-2-enylamino)-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 156548919 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-(2-formylprop-2-enylamino)-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide |
| SMILES | C=C(C=O)CNc1cc(S(=O)(=O)NC)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O4S/c1-13(11-25)10-24-17-9-16(29(26,27)23-2)6-7-18(17)28-12-14-4-3-5-15(8-14)19(20,21)22/h3-9,11,23-24H,1,10,12H2,2H3 |
| InChIKey | QBEYPMJEEGGRBO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|