C5H8NO2S- — CID 156566228
(3E)-4-(sulfinatoamino)penta-1,3-diene (PubChem CID 156566228) has the molecular formula C5H8NO2S- and a molecular weight of 146.19 g/mol. Its IUPAC name is (3E)-4-(sulfinatoamino)penta-1,3-diene.
| Compound Name | (3E)-4-(sulfinatoamino)penta-1,3-diene |
|---|---|
| PubChem CID | 156566228 |
| Molecular Formula | C5H8NO2S- |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | (3E)-4-(sulfinatoamino)penta-1,3-diene |
| SMILES | C=C/C=C(\C)NS(=O)[O-] |
| InChI | InChI=1S/C5H9NO2S/c1-3-4-5(2)6-9(7)8/h3-4,6H,1H2,2H3,(H,7,8)/p-1/b5-4+ |
| InChIKey | SIVLNKPEXBBCEI-SNAWJCMRSA-M |
| XLogP | 0.46 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|