C29H45FO2 — CID 156570741
3-butyl-4-[(3E,7E,11Z)-13-fluoro-4,8,12-trimethyltrideca-3,7,11-trienoxy]-2,5,6-trimethylphenol (PubChem CID 156570741) has the molecular formula C29H45FO2 and a molecular weight of 444.68 g/mol. Its IUPAC name is 3-butyl-4-[(3E,7E,11Z)-13-fluoro-4,8,12-trimethyltrideca-3,7,11-trienoxy]-2,5,6-trimethylphenol.
| Compound Name | 3-butyl-4-[(3E,7E,11Z)-13-fluoro-4,8,12-trimethyltrideca-3,7,11-trienoxy]-2,5,6-trimethylphenol |
|---|---|
| PubChem CID | 156570741 |
| Molecular Formula | C29H45FO2 |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | 3-butyl-4-[(3E,7E,11Z)-13-fluoro-4,8,12-trimethyltrideca-3,7,11-trienoxy]-2,5,6-trimethylphenol |
| SMILES | CCCCc1c(C)c(O)c(C)c(C)c1OCC/C=C(\C)CC/C=C(\C)CC/C=C(/C)CF |
| InChI | InChI=1S/C29H45FO2/c1-8-9-18-27-26(7)28(31)24(5)25(6)29(27)32-19-12-17-22(3)14-10-13-21(2)15-11-16-23(4)20-30/h13,16-17,31H,8-12,14-15,18-20H2,1-7H3/b21-13+,22-17+,23-16- |
| InChIKey | VXCXOUDOBHKEHL-OVQMHDQDSA-N |
| XLogP | 8.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|