C15H15NO2 — CID 15657744
(4aS,10aR)-4a-isocyanato-1,2,3,4,10,10a-hexahydrophenanthren-9-one (PubChem CID 15657744) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (4aS,10aR)-4a-isocyanato-1,2,3,4,10,10a-hexahydrophenanthren-9-one.
| Compound Name | (4aS,10aR)-4a-isocyanato-1,2,3,4,10,10a-hexahydrophenanthren-9-one |
|---|---|
| PubChem CID | 15657744 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (4aS,10aR)-4a-isocyanato-1,2,3,4,10,10a-hexahydrophenanthren-9-one |
| SMILES | O=C=N[C@@]12CCCC[C@@H]1CC(=O)c1ccccc12 |
| InChI | InChI=1S/C15H15NO2/c17-10-16-15-8-4-3-5-11(15)9-14(18)12-6-1-2-7-13(12)15/h1-2,6-7,11H,3-5,8-9H2/t11-,15+/m1/s1 |
| InChIKey | OLVOGSXBURREOA-ABAIWWIYSA-N |
| XLogP | 2.99 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|