C8H11F2N3O2 — CID 15659063
4-amino-1-(2,2-difluoro-4-hydroxybutyl)pyrimidin-2-one (PubChem CID 15659063) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 4-amino-1-(2,2-difluoro-4-hydroxybutyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(2,2-difluoro-4-hydroxybutyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 15659063 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-amino-1-(2,2-difluoro-4-hydroxybutyl)pyrimidin-2-one |
| SMILES | Nc1ccn(CC(F)(F)CCO)c(=O)n1 |
| InChI | InChI=1S/C8H11F2N3O2/c9-8(10,2-4-14)5-13-3-1-6(11)12-7(13)15/h1,3,14H,2,4-5H2,(H2,11,12,15) |
| InChIKey | RKJNYTVHVVXWQY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |