C16H34O4Si2 — CID 15662803
(3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one (PubChem CID 15662803) has the molecular formula C16H34O4Si2 and a molecular weight of 346.62 g/mol. Its IUPAC name is (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one.
| Compound Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one |
|---|---|
| PubChem CID | 15662803 |
| Molecular Formula | C16H34O4Si2 |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1COC(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O4Si2/c1-15(2,3)21(7,8)19-12-11-18-14(17)13(12)20-22(9,10)16(4,5)6/h12-13H,11H2,1-10H3/t12-,13+/m0/s1 |
| InChIKey | QLMNWNMVWITKGL-QWHCGFSZSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|